 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CCN(C(=O)Nc1ccccc1C)C1CCCCC1)C1CC2CCC1(C)C2(C)C |
| InChI: | InChI=1/C26H40N2O2/c1-19-10-8-9-13-22(19)27-24(29)28(21-11-6-5-7-12-21)16-17-30-23-18-20-14-15-26(23,4)25(20,2)3/h8-10,13,20-21,23H,5-7,11-12,14-18H2,1-4H3,(H,27,29)/t20-,23+,26+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=127.452 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 412.618 g/mol | logS: -5.89953 | SlogP: 6.39302 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.150167 | Sterimol/B1: 2.24634 | Sterimol/B2: 3.63651 | Sterimol/B3: 4.91763 | |||
| Sterimol/B4: 10.2553 | Sterimol/L: 16.8545 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 677.572 | Positive charged surface: 487.029 | Negative charged surface: 190.543 | Volume: 441.125 | |||
| Hydrophobic surface: 621.255 | Hydrophilic surface: 56.317 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.