Type: Neutral
Formula: C20H19ClN2O
SMILES: |
Clc1cc(Nc2c3CCCCc3nc3c2cccc3)c(OC)cc1 |
InChI: |
InChI=1/C20H19ClN2O/c1-24-19-11-10-13(21)12-18(19)23-20-14-6-2-4-8-16(14)22-17-9-5-3-7-15(17)20/h2,4,6,8,10-12H,3,5,7,9H2,1H3,(H,22,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.838 g/mol | logS: -5.46722 | SlogP: 5.51914 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.199216 | Sterimol/B1: 2.55261 | Sterimol/B2: 5.17226 | Sterimol/B3: 7.13497 |
Sterimol/B4: 7.85517 | Sterimol/L: 12.8667 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 573.98 | Positive charged surface: 359.653 | Negative charged surface: 211.535 | Volume: 322.625 |
Hydrophobic surface: 542.313 | Hydrophilic surface: 31.667 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |