Type: Neutral
Formula: C18H19N3O3
SMILES: |
O1CCCC1CNC(=O)c1n(c-2c(c1)C(=O)Nc1c-2cccc1)C |
InChI: |
InChI=1/C18H19N3O3/c1-21-15(18(23)19-10-11-5-4-8-24-11)9-13-16(21)12-6-2-3-7-14(12)20-17(13)22/h2-3,6-7,9,11H,4-5,8,10H2,1H3,(H,19,23)(H,20,22)/t11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 325.368 g/mol | logS: -3.43585 | SlogP: 2.5258 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.017269 | Sterimol/B1: 3.05071 | Sterimol/B2: 3.1379 | Sterimol/B3: 4.38321 |
Sterimol/B4: 6.09521 | Sterimol/L: 16.7657 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 562.897 | Positive charged surface: 369.464 | Negative charged surface: 193.434 | Volume: 305.5 |
Hydrophobic surface: 429.833 | Hydrophilic surface: 133.064 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |