Type: Tautomer
Formula: C18H21FN2O4
SMILES: |
Fc1cc(ccc1)C1C2C(=NNC2=O)CC(O)(C)C1C(OC(C)C)=O |
InChI: |
InChI=1/C18H21FN2O4/c1-9(2)25-17(23)15-13(10-5-4-6-11(19)7-10)14-12(8-18(15,3)24)20-21-16(14)22/h4-7,9,13-15,24H,8H2,1-3H3,(H,21,22)/t13-,14-,15+,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 348.374 g/mol | logS: -3.17988 | SlogP: 1.7338 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.219878 | Sterimol/B1: 3.60499 | Sterimol/B2: 4.31376 | Sterimol/B3: 4.34991 |
Sterimol/B4: 6.01143 | Sterimol/L: 13.3338 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 496.932 | Positive charged surface: 301.484 | Negative charged surface: 195.448 | Volume: 305.625 |
Hydrophobic surface: 305.002 | Hydrophilic surface: 191.93 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|