Type: Neutral
Formula: C12H16N2O2
SMILES: |
O1CCCC1C(NC(=O)c1cccnc1)C |
InChI: |
InChI=1/C12H16N2O2/c1-9(11-5-3-7-16-11)14-12(15)10-4-2-6-13-8-10/h2,4,6,8-9,11H,3,5,7H2,1H3,(H,14,15)/t9-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 220.272 g/mol | logS: -1.2951 | SlogP: 1.3789 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.103196 | Sterimol/B1: 2.13173 | Sterimol/B2: 2.43789 | Sterimol/B3: 4.47268 |
Sterimol/B4: 6.59625 | Sterimol/L: 12.9502 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 436.329 | Positive charged surface: 315.886 | Negative charged surface: 120.443 | Volume: 220.625 |
Hydrophobic surface: 362.674 | Hydrophilic surface: 73.655 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |