 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccc(NC(=O)C(N2C(=O)C3C(C4CC3CC4)C2=O)Cc2ccccc2)cc1 |
| InChI: | InChI=1/C24H23FN2O3/c25-17-8-10-18(11-9-17)26-22(28)19(12-14-4-2-1-3-5-14)27-23(29)20-15-6-7-16(13-15)21(20)24(27)30/h1-5,8-11,15-16,19-21H,6-7,12-13H2,(H,26,28)/t15-,16+,19-,20+,21+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=161.836 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.457 g/mol | logS: -5.82301 | SlogP: 3.40657 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0868043 | Sterimol/B1: 2.6582 | Sterimol/B2: 3.78656 | Sterimol/B3: 3.97453 | |||
| Sterimol/B4: 10.5891 | Sterimol/L: 15.3702 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 638.907 | Positive charged surface: 362.303 | Negative charged surface: 276.605 | Volume: 377.75 | |||
| Hydrophobic surface: 567.449 | Hydrophilic surface: 71.458 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.