Type: Neutral
Formula: C22H27NO
SMILES: |
O=C(NC1CCCCC1)CC(c1ccc(cc1)C)c1ccccc1 |
InChI: |
InChI=1/C22H27NO/c1-17-12-14-19(15-13-17)21(18-8-4-2-5-9-18)16-22(24)23-20-10-6-3-7-11-20/h2,4-5,8-9,12-15,20-21H,3,6-7,10-11,16H2,1H3,(H,23,24)/t21-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 321.464 g/mol | logS: -5.06192 | SlogP: 4.96592 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0821095 | Sterimol/B1: 2.66466 | Sterimol/B2: 3.35526 | Sterimol/B3: 4.45789 |
Sterimol/B4: 8.29064 | Sterimol/L: 17.6709 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 621.556 | Positive charged surface: 422.547 | Negative charged surface: 199.01 | Volume: 344.5 |
Hydrophobic surface: 591.28 | Hydrophilic surface: 30.276 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |