 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(NC(=O)C)Cc1ccccc1)C(=O)[O-] |
| InChI: | InChI=1/C20H22N2O5/c1-13(23)21-17(11-14-5-3-2-4-6-14)19(25)22-18(20(26)27)12-15-7-9-16(24)10-8-15/h2-10,17-18,24H,11-12H2,1H3,(H,21,23)(H,22,25)(H,26,27)/p-1/t17-,18+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=70.723 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 369.397 g/mol | logS: -3.49612 | SlogP: -0.08326 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0961524 | Sterimol/B1: 2.56949 | Sterimol/B2: 3.38144 | Sterimol/B3: 3.98027 | |||
| Sterimol/B4: 9.34442 | Sterimol/L: 14.4397 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 622.093 | Positive charged surface: 348.288 | Negative charged surface: 273.805 | Volume: 352.375 | |||
| Hydrophobic surface: 442.818 | Hydrophilic surface: 179.275 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
