 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1ccccc1)C(=O)NC(C(=O)[O-])C)c1ccccc1 |
| InChI: | InChI=1/C19H20N2O4/c1-13(19(24)25)20-18(23)16(12-14-8-4-2-5-9-14)21-17(22)15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3,(H,20,23)(H,21,22)(H,24,25)/p-1/t13-,16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=76.3223 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 339.371 g/mol | logS: -4.11645 | SlogP: 0.28227 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0787709 | Sterimol/B1: 3.00938 | Sterimol/B2: 4.18743 | Sterimol/B3: 4.28247 | |||
| Sterimol/B4: 8.09274 | Sterimol/L: 16.038 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 601.38 | Positive charged surface: 329.216 | Negative charged surface: 272.164 | Volume: 328.625 | |||
| Hydrophobic surface: 440.523 | Hydrophilic surface: 160.857 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
