 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C([O-])c1cc(NC(=O)CCC(=O)[O-])c(NC(=O)CCC(=O)[O-])cc1 |
| InChI: | InChI=1/C15H16N2O8/c18-11(3-5-13(20)21)16-9-2-1-8(15(24)25)7-10(9)17-12(19)4-6-14(22)23/h1-2,7H,3-6H2,(H,16,18)(H,17,19)(H,20,21)(H,22,23)(H,24,25)/p-3 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=44.8864 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 349.275 g/mol | logS: -2.05917 | SlogP: -3.0127 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0210783 | Sterimol/B1: 2.67768 | Sterimol/B2: 2.79464 | Sterimol/B3: 4.1683 | |||
| Sterimol/B4: 9.72834 | Sterimol/L: 16.7945 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 588.226 | Positive charged surface: 281.228 | Negative charged surface: 306.998 | Volume: 293.625 | |||
| Hydrophobic surface: 225.845 | Hydrophilic surface: 362.381 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 6 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
