 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C1N(CCC1)C(=O)C(NC(=O)c1ccccc1)Cc1ccc(cc1)C |
| InChI: | InChI=1/C22H24N2O4/c1-15-9-11-16(12-10-15)14-18(23-20(25)17-6-3-2-4-7-17)21(26)24-13-5-8-19(24)22(27)28/h2-4,6-7,9-12,18-19H,5,8,13-14H2,1H3,(H,23,25)(H,27,28)/t18-,19+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=98.9352 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 380.444 g/mol | logS: -4.4491 | SlogP: 2.41169 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.101088 | Sterimol/B1: 2.33683 | Sterimol/B2: 3.05374 | Sterimol/B3: 4.46314 | |||
| Sterimol/B4: 10.7731 | Sterimol/L: 14.7465 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 654.993 | Positive charged surface: 391.553 | Negative charged surface: 263.44 | Volume: 371.25 | |||
| Hydrophobic surface: 531.965 | Hydrophilic surface: 123.028 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
