 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1ccc(cc1)C)C(=O)N1CCCC1C(=O)[O-])c1ccccc1 |
| InChI: | InChI=1/C22H24N2O4/c1-15-9-11-16(12-10-15)14-18(23-20(25)17-6-3-2-4-7-17)21(26)24-13-5-8-19(24)22(27)28/h2-4,6-7,9-12,18-19H,5,8,13-14H2,1H3,(H,23,25)(H,27,28)/p-1/t18-,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=94.8128 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 379.436 g/mol | logS: -4.70955 | SlogP: 1.07699 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.141961 | Sterimol/B1: 2.40428 | Sterimol/B2: 3.97971 | Sterimol/B3: 4.40753 | |||
| Sterimol/B4: 10.5863 | Sterimol/L: 14.7843 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 648.879 | Positive charged surface: 377.826 | Negative charged surface: 271.053 | Volume: 371.5 | |||
| Hydrophobic surface: 522.355 | Hydrophilic surface: 126.524 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
