 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(=O)C1C(C2C(=NC1=C)CC(CC2=O)c1ccccc1)c1ccc(O)cc1)C1CCCC1 |
| InChI: | InChI=1/C28H29NO4/c1-17-25(28(32)33-22-9-5-6-10-22)26(19-11-13-21(30)14-12-19)27-23(29-17)15-20(16-24(27)31)18-7-3-2-4-8-18/h2-4,7-8,11-14,20,22,25-27,30H,1,5-6,9-10,15-16H2/t20-,25-,26+,27+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=150.584 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 443.543 g/mol | logS: -4.89427 | SlogP: 5.309 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.149622 | Sterimol/B1: 2.70744 | Sterimol/B2: 3.88342 | Sterimol/B3: 6.49517 | |||
| Sterimol/B4: 6.79462 | Sterimol/L: 16.6662 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 653.558 | Positive charged surface: 449.507 | Negative charged surface: 204.051 | Volume: 427.375 | |||
| Hydrophobic surface: 541.034 | Hydrophilic surface: 112.524 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
