 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccc(cc1)/C(/O)=C/1\C(N(CC2OCCC2)C(=O)C\1=O)c1cc(OC)ccc1 |
| InChI: | InChI=1/C23H22FNO5/c1-29-17-5-2-4-15(12-17)20-19(21(26)14-7-9-16(24)10-8-14)22(27)23(28)25(20)13-18-6-3-11-30-18/h2,4-5,7-10,12,18,20,26H,3,6,11,13H2,1H3/b21-19+/t18-,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=107.364 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.429 g/mol | logS: -4.90298 | SlogP: 3.5305 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.173763 | Sterimol/B1: 2.14592 | Sterimol/B2: 3.47569 | Sterimol/B3: 5.3147 | |||
| Sterimol/B4: 10.3301 | Sterimol/L: 16.6842 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 658.399 | Positive charged surface: 435.793 | Negative charged surface: 222.606 | Volume: 375.75 | |||
| Hydrophobic surface: 551.963 | Hydrophilic surface: 106.436 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
