Type: Neutral
Formula: C15H21NO
SMILES: |
O=C(NC1CCCCC1C)c1cc(ccc1)C |
InChI: |
InChI=1/C15H21NO/c1-11-6-5-8-13(10-11)15(17)16-14-9-4-3-7-12(14)2/h5-6,8,10,12,14H,3-4,7,9H2,1-2H3,(H,16,17)/t12-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 231.339 g/mol | logS: -3.67784 | SlogP: 3.30352 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0730736 | Sterimol/B1: 2.94401 | Sterimol/B2: 3.02553 | Sterimol/B3: 3.91932 |
Sterimol/B4: 5.40794 | Sterimol/L: 15.0012 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 480.644 | Positive charged surface: 320.398 | Negative charged surface: 160.246 | Volume: 251.5 |
Hydrophobic surface: 430.059 | Hydrophilic surface: 50.585 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |