Type: Neutral
Formula: C18H17N3O2S
SMILES: |
s1c2CC(CCc2c2c1ncnc2Nc1cc2OCOc2cc1)C |
InChI: |
InChI=1/C18H17N3O2S/c1-10-2-4-12-15(6-10)24-18-16(12)17(19-8-20-18)21-11-3-5-13-14(7-11)23-9-22-13/h3,5,7-8,10H,2,4,6,9H2,1H3,(H,19,20,21)/t10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 339.419 g/mol | logS: -6.04338 | SlogP: 4.28834 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0255721 | Sterimol/B1: 2.46586 | Sterimol/B2: 2.73397 | Sterimol/B3: 3.09767 |
Sterimol/B4: 7.99151 | Sterimol/L: 16.464 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 561.163 | Positive charged surface: 373.952 | Negative charged surface: 180.951 | Volume: 307.25 |
Hydrophobic surface: 411.719 | Hydrophilic surface: 149.444 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |