Type: Neutral
Formula: C16H18ClN3O4
SMILES: |
Clc1cc(N2C(=O)C(NC(=O)CCCNC(=O)C)CC2=O)ccc1 |
InChI: |
InChI=1/C16H18ClN3O4/c1-10(21)18-7-3-6-14(22)19-13-9-15(23)20(16(13)24)12-5-2-4-11(17)8-12/h2,4-5,8,13H,3,6-7,9H2,1H3,(H,18,21)(H,19,22)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 351.79 g/mol | logS: -3.06953 | SlogP: 1.0044 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.038244 | Sterimol/B1: 3.1271 | Sterimol/B2: 3.57207 | Sterimol/B3: 3.81761 |
Sterimol/B4: 6.25043 | Sterimol/L: 20.1577 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 619.723 | Positive charged surface: 345.801 | Negative charged surface: 273.921 | Volume: 312.875 |
Hydrophobic surface: 453.822 | Hydrophilic surface: 165.901 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |