 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC)c1cc(ccc1OCC)CCNC(=O)C1CC(=CCC1C(=O)[O-])C |
| InChI: | InChI=1/C21H29NO5/c1-4-26-18-9-7-15(13-19(18)27-5-2)10-11-22-20(23)17-12-14(3)6-8-16(17)21(24)25/h6-7,9,13,16-17H,4-5,8,10-12H2,1-3H3,(H,22,23)(H,24,25)/p-1/t16-,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=33.4973 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 374.457 g/mol | logS: -2.86581 | SlogP: 1.86507 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0329652 | Sterimol/B1: 3.6401 | Sterimol/B2: 3.89339 | Sterimol/B3: 3.95248 | |||
| Sterimol/B4: 7.36708 | Sterimol/L: 19.9299 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 705.449 | Positive charged surface: 490.749 | Negative charged surface: 214.7 | Volume: 375.875 | |||
| Hydrophobic surface: 542.559 | Hydrophilic surface: 162.89 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
