Type: Neutral
Formula: C19H20N2O
SMILES: |
O=C(N\N=C\1/CCCCc2c/1cccc2)c1ccc(cc1)C |
InChI: |
InChI=1/C19H20N2O/c1-14-10-12-16(13-11-14)19(22)21-20-18-9-5-3-7-15-6-2-4-8-17(15)18/h2,4,6,8,10-13H,3,5,7,9H2,1H3,(H,21,22)/b20-18+ |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 292.382 g/mol | logS: -5.4071 | SlogP: 3.85549 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0473859 | Sterimol/B1: 3.30195 | Sterimol/B2: 3.59932 | Sterimol/B3: 4.31521 |
Sterimol/B4: 5.05444 | Sterimol/L: 17.477 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 557.396 | Positive charged surface: 326.762 | Negative charged surface: 230.634 | Volume: 301 |
Hydrophobic surface: 504.617 | Hydrophilic surface: 52.779 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |