Type: Neutral
Formula: C12H23NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1OC(C)(C)C |
InChI: |
InChI=1/C12H23NO6/c1-6(15)13-8-10(17)9(16)7(5-14)18-11(8)19-12(2,3)4/h7-11,14,16-17H,5H2,1-4H3,(H,13,15)/t7-,8-,9-,10-,11+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 277.317 g/mol | logS: -0.45933 | SlogP: -1.2548 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.13117 | Sterimol/B1: 2.55015 | Sterimol/B2: 3.31416 | Sterimol/B3: 3.53306 |
Sterimol/B4: 8.16122 | Sterimol/L: 11.8607 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 489.884 | Positive charged surface: 354.951 | Negative charged surface: 134.933 | Volume: 261.75 |
Hydrophobic surface: 277.79 | Hydrophilic surface: 212.094 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |