Type: Ionized
Formula: C3H12NO7P2+
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(O)CC[NH3+] |
InChI: |
InChI=1/C3H11NO7P2/c4-2-1-3(5,12(6,7)8)13(9,10)11/h5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11)/p+1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 236.077 g/mol | logS: 1.97038 | SlogP: -4.5205 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.2377 | Sterimol/B1: 3.509 | Sterimol/B2: 3.63806 | Sterimol/B3: 4.03735 |
Sterimol/B4: 5.27331 | Sterimol/L: 10.31 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 378.976 | Positive charged surface: 249.205 | Negative charged surface: 129.772 | Volume: 167.5 |
Hydrophobic surface: 45.6258 | Hydrophilic surface: 333.3502 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 1 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|