Type: Neutral
Formula: C8H22N2O6P2
SMILES: |
P(O)(O)(=O)C(NCCNC(P(O)(O)=O)(C)C)(C)C |
InChI: |
InChI=1/C8H22N2O6P2/c1-7(2,17(11,12)13)9-5-6-10-8(3,4)18(14,15)16/h9-10H,5-6H2,1-4H3,(H2,11,12,13)(H2,14,15,16) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 304.22 g/mol | logS: 0.79386 | SlogP: -2.1472 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.107435 | Sterimol/B1: 2.33034 | Sterimol/B2: 3.82842 | Sterimol/B3: 4.12653 |
Sterimol/B4: 5.62291 | Sterimol/L: 15.8712 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 508.935 | Positive charged surface: 303.534 | Negative charged surface: 205.4 | Volume: 256.625 |
Hydrophobic surface: 178.123 | Hydrophilic surface: 330.812 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |