Type: Neutral
Formula: C16H18N4O3
SMILES: |
O1CCCC1CNC(=O)C(=O)N\N=C\c1c2c([nH]c1)cccc2 |
InChI: |
InChI=1/C16H18N4O3/c21-15(18-10-12-4-3-7-23-12)16(22)20-19-9-11-8-17-14-6-2-1-5-13(11)14/h1-2,5-6,8-9,12,17H,3-4,7,10H2,(H,18,21)(H,20,22)/b19-9+/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.345 g/mol | logS: -2.92774 | SlogP: 0.9132 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0139716 | Sterimol/B1: 2.43638 | Sterimol/B2: 2.74774 | Sterimol/B3: 3.54731 |
Sterimol/B4: 7.06885 | Sterimol/L: 19.1985 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.85 | Positive charged surface: 384.812 | Negative charged surface: 198.195 | Volume: 295.875 |
Hydrophobic surface: 401.23 | Hydrophilic surface: 187.62 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |