Type: Neutral
Formula: C12H18NO5P
SMILES: |
P(O)(O)(=O)CCCC(N)(Cc1ccccc1)C(O)=O |
InChI: |
InChI=1/C12H18NO5P/c13-12(11(14)15,7-4-8-19(16,17)18)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9,13H2,(H,14,15)(H2,16,17,18)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 287.252 g/mol | logS: -0.84113 | SlogP: -0.10113 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0821048 | Sterimol/B1: 2.98097 | Sterimol/B2: 3.78773 | Sterimol/B3: 3.87584 |
Sterimol/B4: 4.24925 | Sterimol/L: 15.9938 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 500.384 | Positive charged surface: 295.016 | Negative charged surface: 205.368 | Volume: 258 |
Hydrophobic surface: 268.168 | Hydrophilic surface: 232.216 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |