Type: Neutral
Formula: C13H26N4O6
SMILES: |
OC(C(N)C(=O)NC(C(=O)NC(CCCCN)C(O)=O)CO)C |
InChI: |
InChI=1/C13H26N4O6/c1-7(19)10(15)12(21)17-9(6-18)11(20)16-8(13(22)23)4-2-3-5-14/h7-10,18-19H,2-6,14-15H2,1H3,(H,16,20)(H,17,21)(H,22,23)/t7-,8+,9+,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.373 g/mol | logS: 0.15832 | SlogP: -3.13 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0921178 | Sterimol/B1: 2.32728 | Sterimol/B2: 4.14758 | Sterimol/B3: 5.72389 |
Sterimol/B4: 7.11134 | Sterimol/L: 16.5316 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 612.575 | Positive charged surface: 452.542 | Negative charged surface: 160.033 | Volume: 312.25 |
Hydrophobic surface: 264.257 | Hydrophilic surface: 348.318 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |