 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC1c2c(-c3c1cccc3)cccc2)C(=O)NC(CCCNC(N(C)C)=N)C(O)=O |
| InChI: | InChI=1/C23H28N4O4/c1-27(2)22(24)25-13-7-12-20(21(28)29)26-23(30)31-14-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,19-20H,7,12-14H2,1-2H3,(H2,24,25)(H,26,30)(H,28,29)/t20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=38.2441 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 424.501 g/mol | logS: -4.60058 | SlogP: 2.84447 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0828259 | Sterimol/B1: 3.38442 | Sterimol/B2: 3.64948 | Sterimol/B3: 5.40647 | |||
| Sterimol/B4: 8.9199 | Sterimol/L: 20.0533 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 765.077 | Positive charged surface: 515.393 | Negative charged surface: 238.934 | Volume: 412.125 | |||
| Hydrophobic surface: 581.509 | Hydrophilic surface: 183.568 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
