 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC([NH3+])C(=O)NC(Cc1c2c([nH]c1)cccc2)C(=O)N |
| InChI: | InChI=1/C20H22N4O3/c21-16(9-12-5-7-14(25)8-6-12)20(27)24-18(19(22)26)10-13-11-23-17-4-2-1-3-15(13)17/h1-8,11,16,18,23,25H,9-10,21H2,(H2,22,26)(H,24,27)/p+1/t16-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=61.2437 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 367.429 g/mol | logS: -3.29533 | SlogP: 0.23924 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.150709 | Sterimol/B1: 2.42292 | Sterimol/B2: 3.41771 | Sterimol/B3: 5.87057 | |||
| Sterimol/B4: 9.14988 | Sterimol/L: 15.1042 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 603.102 | Positive charged surface: 385.189 | Negative charged surface: 214.953 | Volume: 354.5 | |||
| Hydrophobic surface: 365.648 | Hydrophilic surface: 237.454 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
