 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1c2c([nH]c1)cccc2)C(=O)[O-])C([NH3+])CC(=O)[O-] |
| InChI: | InChI=1/C15H17N3O5/c16-10(6-13(19)20)14(21)18-12(15(22)23)5-8-7-17-11-4-2-1-3-9(8)11/h1-4,7,10,12,17H,5-6,16H2,(H,18,21)(H,19,20)(H,22,23)/p-1/t10-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=1.88908 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 318.309 g/mol | logS: -1.94385 | SlogP: -3.30443 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.309318 | Sterimol/B1: 2.50545 | Sterimol/B2: 3.30153 | Sterimol/B3: 5.96851 | |||
| Sterimol/B4: 8.08425 | Sterimol/L: 12.5593 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 501.873 | Positive charged surface: 277.136 | Negative charged surface: 221.214 | Volume: 282 | |||
| Hydrophobic surface: 245.302 | Hydrophilic surface: 256.571 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
