Type: Ionized
Formula: C9H22N6O2+2
SMILES: |
O=C(N)C(NC(=O)C([NH3+])CCCNC(=[NH2+])N)C |
InChI: |
InChI=1/C9H20N6O2/c1-5(7(11)16)15-8(17)6(10)3-2-4-14-9(12)13/h5-6H,2-4,10H2,1H3,(H2,11,16)(H,15,17)(H4,12,13,14)/p+2/t5-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 246.315 g/mol | logS: -0.73554 | SlogP: -4.9695 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0494535 | Sterimol/B1: 2.74137 | Sterimol/B2: 3.47235 | Sterimol/B3: 4.27651 |
Sterimol/B4: 5.26286 | Sterimol/L: 16.1868 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 518.812 | Positive charged surface: 414.009 | Negative charged surface: 104.803 | Volume: 242.5 |
Hydrophobic surface: 159.316 | Hydrophilic surface: 359.496 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 4 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|