 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(NC(=O)C(N)CC(O)=O)C(C)C)C(O)=O |
| InChI: | InChI=1/C18H25N3O7/c1-9(2)15(21-16(25)12(19)8-14(23)24)17(26)20-13(18(27)28)7-10-3-5-11(22)6-4-10/h3-6,9,12-13,15,22H,7-8,19H2,1-2H3,(H,20,26)(H,21,25)(H,23,24)(H,27,28)/t12-,13-,15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.5721 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 395.412 g/mol | logS: -1.69881 | SlogP: -0.55313 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.153001 | Sterimol/B1: 2.38264 | Sterimol/B2: 3.22997 | Sterimol/B3: 5.72394 | |||
| Sterimol/B4: 9.09921 | Sterimol/L: 14.0445 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 652.374 | Positive charged surface: 411.987 | Negative charged surface: 240.387 | Volume: 360.375 | |||
| Hydrophobic surface: 303.492 | Hydrophilic surface: 348.882 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
