 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(Cc1nc[nH]c1)C(=O)NCC(O)=O |
| InChI: | InChI=1/C16H18N4O5/c21-14(22)8-18-15(23)13(6-12-7-17-10-19-12)20-16(24)25-9-11-4-2-1-3-5-11/h1-5,7,10,13H,6,8-9H2,(H,17,19)(H,18,23)(H,20,24)(H,21,22)/t13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=50.0505 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 346.343 g/mol | logS: -2.36275 | SlogP: 0.71437 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0536292 | Sterimol/B1: 2.95965 | Sterimol/B2: 2.96469 | Sterimol/B3: 4.03095 | |||
| Sterimol/B4: 7.60693 | Sterimol/L: 18.7513 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 608.732 | Positive charged surface: 397.311 | Negative charged surface: 211.421 | Volume: 312.125 | |||
| Hydrophobic surface: 361.777 | Hydrophilic surface: 246.955 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.