 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)c1ccc(NC(=O)C(NC(=O)c2ccccc2)CCCNC(N)=N)cc1 |
| InChI: | InChI=1/C20H23N5O4/c21-20(22)23-12-4-7-16(25-17(26)13-5-2-1-3-6-13)18(27)24-15-10-8-14(9-11-15)19(28)29/h1-3,5-6,8-11,16H,4,7,12H2,(H,24,27)(H,25,26)(H,28,29)(H4,21,22,23)/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=60.5269 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 397.435 g/mol | logS: -4.22092 | SlogP: 1.38517 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0954698 | Sterimol/B1: 2.44576 | Sterimol/B2: 3.60874 | Sterimol/B3: 4.04518 | |||
| Sterimol/B4: 11.4845 | Sterimol/L: 18.5363 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 690.652 | Positive charged surface: 432.839 | Negative charged surface: 257.813 | Volume: 368.875 | |||
| Hydrophobic surface: 395.363 | Hydrophilic surface: 295.289 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 7 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.