 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CCCNC(=[NH2+])N)C(=O)Nc1cc2c(cc1)cccc2)c1ccccc1 |
| InChI: | InChI=1/C23H25N5O2/c24-23(25)26-14-6-11-20(28-21(29)17-8-2-1-3-9-17)22(30)27-19-13-12-16-7-4-5-10-18(16)15-19/h1-5,7-10,12-13,15,20H,6,11,14H2,(H,27,30)(H,28,29)(H4,24,25,26)/p+1/t20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=2.38574 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.494 g/mol | logS: -6.10501 | SlogP: 1.0205 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0679059 | Sterimol/B1: 2.4163 | Sterimol/B2: 3.43682 | Sterimol/B3: 4.22424 | |||
| Sterimol/B4: 12.4339 | Sterimol/L: 19.3026 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 746.055 | Positive charged surface: 469.203 | Negative charged surface: 266.496 | Volume: 404.75 | |||
| Hydrophobic surface: 531.402 | Hydrophilic surface: 214.653 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
