Type: Neutral
Formula: C14H17N3O3
| SMILES: |
OC(=O)C(NC(=O)C(N)Cc1c2c([nH]c1)cccc2)C |
| InChI: |
InChI=1/C14H17N3O3/c1-8(14(19)20)17-13(18)11(15)6-9-7-16-12-5-3-2-4-10(9)12/h2-5,7-8,11,16H,6,15H2,1H3,(H,17,18)(H,19,20)/t8-,11-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 275.308 g/mol | logS: -1.89679 | SlogP: 0.62697 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0442205 | Sterimol/B1: 2.29014 | Sterimol/B2: 3.12627 | Sterimol/B3: 4.03034 |
| Sterimol/B4: 5.31098 | Sterimol/L: 16.0056 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 508.022 | Positive charged surface: 306.592 | Negative charged surface: 198.262 | Volume: 260.875 |
| Hydrophobic surface: 278.375 | Hydrophilic surface: 229.647 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |