Type: Neutral
Formula: C14H19N3O4
SMILES: |
OC(=O)C(NC(=O)C(NC(=O)CN)C)Cc1ccccc1 |
InChI: |
InChI=1/C14H19N3O4/c1-9(16-12(18)8-15)13(19)17-11(14(20)21)7-10-5-3-2-4-6-10/h2-6,9,11H,7-8,15H2,1H3,(H,16,18)(H,17,19)(H,20,21)/t9-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 293.323 g/mol | logS: -1.77946 | SlogP: -0.73813 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.121177 | Sterimol/B1: 2.12976 | Sterimol/B2: 4.49019 | Sterimol/B3: 5.10619 |
Sterimol/B4: 7.28021 | Sterimol/L: 14.082 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 546.194 | Positive charged surface: 349.172 | Negative charged surface: 197.021 | Volume: 278.125 |
Hydrophobic surface: 308.079 | Hydrophilic surface: 238.115 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |