 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12NC(C1C2C(=O)N(CCOC)C1=O)CCC(=O)[O-] |
| InChI: | InChI=1/C19H21N3O6/c1-28-9-8-22-16(25)14-12(6-7-13(23)24)21-19(15(14)17(22)26)10-4-2-3-5-11(10)20-18(19)27/h2-5,12,14-15,21H,6-9H2,1H3,(H,20,27)(H,23,24)/p-1/t12-,14+,15-,19+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=47.8638 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 386.384 g/mol | logS: -2.22346 | SlogP: -1.105 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.193672 | Sterimol/B1: 3.85915 | Sterimol/B2: 5.00531 | Sterimol/B3: 6.53308 | |||
| Sterimol/B4: 7.32655 | Sterimol/L: 13.6929 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 605.938 | Positive charged surface: 391.535 | Negative charged surface: 214.402 | Volume: 341.875 | |||
| Hydrophobic surface: 381.913 | Hydrophilic surface: 224.025 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
