Type: Neutral
Formula: C15H20N2O3
SMILES: |
O(C(=O)C(NC(=O)NC1CCCc2c1cccc2)C)C |
InChI: |
InChI=1/C15H20N2O3/c1-10(14(18)20-2)16-15(19)17-13-9-5-7-11-6-3-4-8-12(11)13/h3-4,6,8,10,13H,5,7,9H2,1-2H3,(H2,16,17,19)/t10-,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 276.336 g/mol | logS: -3.00847 | SlogP: 2.02017 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.036465 | Sterimol/B1: 2.93381 | Sterimol/B2: 3.07005 | Sterimol/B3: 3.49096 |
Sterimol/B4: 6.31243 | Sterimol/L: 16.099 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 521.984 | Positive charged surface: 369.016 | Negative charged surface: 152.968 | Volume: 271.875 |
Hydrophobic surface: 415.185 | Hydrophilic surface: 106.799 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |