Type: Neutral
Formula: C12H23NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1OCC(C)C |
InChI: |
InChI=1/C12H23NO6/c1-6(2)5-18-12-9(13-7(3)15)11(17)10(16)8(4-14)19-12/h6,8-12,14,16-17H,4-5H2,1-3H3,(H,13,15)/t8-,9-,10-,11-,12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 277.317 g/mol | logS: -0.20845 | SlogP: -1.3973 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0679557 | Sterimol/B1: 2.78647 | Sterimol/B2: 3.27844 | Sterimol/B3: 5.32909 |
Sterimol/B4: 6.44132 | Sterimol/L: 12.7549 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 511.429 | Positive charged surface: 374.29 | Negative charged surface: 137.139 | Volume: 264.375 |
Hydrophobic surface: 302.252 | Hydrophilic surface: 209.177 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |