 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1c(OC)c2C=3C(=CC(=O)C(NCCN)=CC=3)C(NC(=O)C)CCc2cc1OC |
| InChI: | InChI=1/C23H29N3O5/c1-13(27)26-17-7-5-14-11-20(29-2)22(30-3)23(31-4)21(14)15-6-8-18(25-10-9-24)19(28)12-16(15)17/h6,8,11-12,17H,5,7,9-10,24H2,1-4H3,(H,25,28)(H,26,27)/t17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=181.743 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 427.501 g/mol | logS: -3.61583 | SlogP: 1.48797 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.158035 | Sterimol/B1: 2.23417 | Sterimol/B2: 2.95844 | Sterimol/B3: 6.44995 | |||
| Sterimol/B4: 11.4742 | Sterimol/L: 18.096 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 700.198 | Positive charged surface: 555.88 | Negative charged surface: 144.317 | Volume: 408.375 | |||
| Hydrophobic surface: 525.809 | Hydrophilic surface: 174.389 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
