Type: Neutral
Formula: C20H26O
SMILES: |
O=C1CCC2C3C(CCC12C)C1(C(=CC(C=C1)=C)CC3)C |
InChI: |
InChI=1/C20H26O/c1-13-8-10-19(2)14(12-13)4-5-15-16-6-7-18(21)20(16,3)11-9-17(15)19/h8,10,12,15-17H,1,4-7,9,11H2,2-3H3/t15-,16-,17-,19-,20-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 282.427 g/mol | logS: -5.26831 | SlogP: 4.8505 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.139753 | Sterimol/B1: 2.62988 | Sterimol/B2: 3.43254 | Sterimol/B3: 4.70253 |
Sterimol/B4: 5.43832 | Sterimol/L: 14.3151 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 492.748 | Positive charged surface: 316.634 | Negative charged surface: 171.189 | Volume: 300 |
Hydrophobic surface: 382.522 | Hydrophilic surface: 110.226 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |