 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(C(C[NH+]3CCN(CC3)c3cc(ccc3)C)C1=O)C(O)C1(C(C2)=CCCC1C) C |
| InChI: | InChI=1/C26H36N2O3/c1-17-6-4-9-20(14-17)28-12-10-27(11-13-28)16-21-23-22(31-25(21)30)15-19-8-5-7-18(2)26(19,3)24(23)29/h4,6,8-9,14,18,21-24,29H,5,7,10-13,15-16H2,1-3H3/p+1/t18-,21+,22+,23+,24+,26+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=115.352 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.593 g/mol | logS: -4.07667 | SlogP: 1.98492 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0769954 | Sterimol/B1: 2.45706 | Sterimol/B2: 3.63503 | Sterimol/B3: 6.01019 | |||
| Sterimol/B4: 6.55888 | Sterimol/L: 20.1525 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 698.475 | Positive charged surface: 515.63 | Negative charged surface: 182.845 | Volume: 438 | |||
| Hydrophobic surface: 564.641 | Hydrophilic surface: 133.834 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
