 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C1N(CCC1)C(=O)C(NC(CCc1ccccc1)C(O)=O)CCCCN |
| InChI: | InChI=1/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=94.473 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.495 g/mol | logS: -2.29593 | SlogP: 1.23517 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.162327 | Sterimol/B1: 3.32053 | Sterimol/B2: 6.59883 | Sterimol/B3: 6.89606 | |||
| Sterimol/B4: 7.13284 | Sterimol/L: 16.285 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 714.426 | Positive charged surface: 498.789 | Negative charged surface: 215.637 | Volume: 397.25 | |||
| Hydrophobic surface: 474.733 | Hydrophilic surface: 239.693 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
