Type: Neutral
Formula: C16H26N2O7
SMILES: |
O1C2C(OC1(C)C)C1OC(OC1OC2C(=O)NC(C(=O)NC)C)(C)C |
InChI: |
InChI=1/C16H26N2O7/c1-7(12(19)17-6)18-13(20)10-8-9(23-15(2,3)22-8)11-14(21-10)25-16(4,5)24-11/h7-11,14H,1-6H3,(H,17,19)(H,18,20)/t7-,8+,9-,10+,11+,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 358.391 g/mol | logS: -2.7241 | SlogP: -0.3664 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0826475 | Sterimol/B1: 2.15418 | Sterimol/B2: 3.01968 | Sterimol/B3: 5.22108 |
Sterimol/B4: 8.25006 | Sterimol/L: 16.8236 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 593.465 | Positive charged surface: 430.734 | Negative charged surface: 162.73 | Volume: 327.875 |
Hydrophobic surface: 383.659 | Hydrophilic surface: 209.806 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |