 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C([O-])C(NC(=O)NC(CC)C)Cc1ccccc1 |
| InChI: | InChI=1/C14H20N2O3/c1-3-10(2)15-14(19)16-12(13(17)18)9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,17,18)(H2,15,16,19)/p-1/t10-,12+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=13.1134 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 263.317 g/mol | logS: -2.54618 | SlogP: 0.44527 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.115111 | Sterimol/B1: 2.84857 | Sterimol/B2: 4.2255 | Sterimol/B3: 5.28828 | |||
| Sterimol/B4: 6.01882 | Sterimol/L: 12.8995 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 503.757 | Positive charged surface: 308.477 | Negative charged surface: 195.281 | Volume: 266.75 | |||
| Hydrophobic surface: 341.985 | Hydrophilic surface: 161.772 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
