Type: Neutral
Formula: C21H28N2O
SMILES: |
O=C1N2CCCc3c([nH]c4c3cccc4)C2(C)C(CC1C)CCC |
InChI: |
InChI=1/C21H28N2O/c1-4-8-15-13-14(2)20(24)23-12-7-10-17-16-9-5-6-11-18(16)22-19(17)21(15,23)3/h5-6,9,11,14-15,22H,4,7-8,10,12-13H2,1-3H3/t14-,15-,21+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.468 g/mol | logS: -4.44897 | SlogP: 4.92547 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.294586 | Sterimol/B1: 2.64471 | Sterimol/B2: 3.41702 | Sterimol/B3: 5.72556 |
Sterimol/B4: 8.32145 | Sterimol/L: 13.8433 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 551.42 | Positive charged surface: 370.021 | Negative charged surface: 176.284 | Volume: 337.125 |
Hydrophobic surface: 466.536 | Hydrophilic surface: 84.884 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |