Type: Neutral
Formula: C17H20N2O4S2
SMILES: |
s1cc(S(=O)(=O)N2CC(CCC2)C)cc1C(=O)Nc1cc(O)ccc1 |
InChI: |
InChI=1/C17H20N2O4S2/c1-12-4-3-7-19(10-12)25(22,23)15-9-16(24-11-15)17(21)18-13-5-2-6-14(20)8-13/h2,5-6,8-9,11-12,20H,3-4,7,10H2,1H3,(H,18,21)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 380.489 g/mol | logS: -3.66907 | SlogP: 3.1266 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0364499 | Sterimol/B1: 2.04063 | Sterimol/B2: 3.61741 | Sterimol/B3: 3.98248 |
Sterimol/B4: 7.97775 | Sterimol/L: 17.7262 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 615.798 | Positive charged surface: 346.964 | Negative charged surface: 268.834 | Volume: 335.75 |
Hydrophobic surface: 448 | Hydrophilic surface: 167.798 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |