Type: Neutral
Formula: C19H25NO6
SMILES: |
O1C2C(OC1(C)C)C1OC(OC1OC2C(=O)NCc1ccccc1)(C)C |
InChI: |
InChI=1/C19H25NO6/c1-18(2)23-12-13(24-18)15-17(26-19(3,4)25-15)22-14(12)16(21)20-10-11-8-6-5-7-9-11/h5-9,12-15,17H,10H2,1-4H3,(H,20,21)/t12-,13+,14+,15+,17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 363.41 g/mol | logS: -3.99222 | SlogP: 1.9657 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0903107 | Sterimol/B1: 1.969 | Sterimol/B2: 3.49537 | Sterimol/B3: 4.63641 |
Sterimol/B4: 8.00272 | Sterimol/L: 17.2615 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 582.118 | Positive charged surface: 374.795 | Negative charged surface: 207.324 | Volume: 334 |
Hydrophobic surface: 423.829 | Hydrophilic surface: 158.289 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |