Type: Neutral
Formula: C16H24N2O6S
SMILES: |
S(=O)(=O)(NC(C(=O)NCC1OCCC1)C)c1cc(OC)c(OC)cc1 |
InChI: |
InChI=1/C16H24N2O6S/c1-11(16(19)17-10-12-5-4-8-24-12)18-25(20,21)13-6-7-14(22-2)15(9-13)23-3/h6-7,9,11-12,18H,4-5,8,10H2,1-3H3,(H,17,19)/t11-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 372.442 g/mol | logS: -2.51842 | SlogP: 0.6658 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0721498 | Sterimol/B1: 3.17461 | Sterimol/B2: 4.50268 | Sterimol/B3: 5.65723 |
Sterimol/B4: 6.21324 | Sterimol/L: 18.1961 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 630.985 | Positive charged surface: 456.099 | Negative charged surface: 174.886 | Volume: 336.875 |
Hydrophobic surface: 469.727 | Hydrophilic surface: 161.258 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |