 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(=O)C)C1CC2(C(C3CCc4c(ccc(OC(=O)C)c4)C13O)CCC2=O)C |
| InChI: | InChI=1/C22H26O6/c1-12(23)27-15-5-7-16-14(10-15)4-6-18-17-8-9-19(25)21(17,3)11-20(22(16,18)26)28-13(2)24/h5,7,10,17-18,20,26H,4,6,8-9,11H2,1-3H3/t17-,18+,20-,21-,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=153.755 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 386.444 g/mol | logS: -3.64944 | SlogP: 2.99417 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0881767 | Sterimol/B1: 3.09884 | Sterimol/B2: 4.04507 | Sterimol/B3: 4.39554 | |||
| Sterimol/B4: 7.66913 | Sterimol/L: 16.1982 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 609.866 | Positive charged surface: 385.699 | Negative charged surface: 224.167 | Volume: 360.375 | |||
| Hydrophobic surface: 471.461 | Hydrophilic surface: 138.405 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.