 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(=O)C(NC(=O)C(NC(=O)C([NH3+])Cc1ccccc1)C)CO)C |
| InChI: | InChI=1/C16H23N3O5/c1-10(14(21)19-13(9-20)16(23)24-2)18-15(22)12(17)8-11-6-4-3-5-7-11/h3-7,10,12-13,20H,8-9,17H2,1-2H3,(H,18,22)(H,19,21)/p+1/t10-,12-,13+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=64.7702 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 338.384 g/mol | logS: -1.96486 | SlogP: -2.00563 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0765917 | Sterimol/B1: 2.36555 | Sterimol/B2: 3.12977 | Sterimol/B3: 4.8195 | |||
| Sterimol/B4: 6.92669 | Sterimol/L: 18.4167 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 624.462 | Positive charged surface: 428.061 | Negative charged surface: 196.4 | Volume: 327.375 | |||
| Hydrophobic surface: 419.749 | Hydrophilic surface: 204.713 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
